C16H21Cl2NO2 — CID 76911154
3-(3,5-dichlorophenyl)-N-(2-hydroxyethyl)-N-pentan-3-ylprop-2-enamide (PubChem CID 76911154) has the molecular formula C16H21Cl2NO2 and a molecular weight of 330.26 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-N-(2-hydroxyethyl)-N-pentan-3-ylprop-2-enamide.
| Compound Name | 3-(3,5-dichlorophenyl)-N-(2-hydroxyethyl)-N-pentan-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 76911154 |
| Molecular Formula | C16H21Cl2NO2 |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-N-(2-hydroxyethyl)-N-pentan-3-ylprop-2-enamide |
| SMILES | CCC(CC)N(CCO)C(=O)C=Cc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H21Cl2NO2/c1-3-15(4-2)19(7-8-20)16(21)6-5-12-9-13(17)11-14(18)10-12/h5-6,9-11,15,20H,3-4,7-8H2,1-2H3 |
| InChIKey | VAXWEXWMFHPRPF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|