C13H18F3N3O2 — CID 76912679
3-[1,3-dimethyl-5-[propan-2-yl(2,2,2-trifluoroethyl)amino]pyrazol-4-yl]prop-2-enoic acid (PubChem CID 76912679) has the molecular formula C13H18F3N3O2 and a molecular weight of 305.30 g/mol. Its IUPAC name is 3-[1,3-dimethyl-5-[propan-2-yl(2,2,2-trifluoroethyl)amino]pyrazol-4-yl]prop-2-enoic acid.
| Compound Name | 3-[1,3-dimethyl-5-[propan-2-yl(2,2,2-trifluoroethyl)amino]pyrazol-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76912679 |
| Molecular Formula | C13H18F3N3O2 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 3-[1,3-dimethyl-5-[propan-2-yl(2,2,2-trifluoroethyl)amino]pyrazol-4-yl]prop-2-enoic acid |
| SMILES | Cc1nn(C)c(N(CC(F)(F)F)C(C)C)c1C=CC(=O)O |
| InChI | InChI=1S/C13H18F3N3O2/c1-8(2)19(7-13(14,15)16)12-10(5-6-11(20)21)9(3)17-18(12)4/h5-6,8H,7H2,1-4H3,(H,20,21) |
| InChIKey | VXTJGVYNTCDZCQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|