C12H16F3N3O2 — CID 77073239
3-[1,3-dimethyl-5-[methyl(3,3,3-trifluoropropyl)amino]pyrazol-4-yl]prop-2-enoic acid (PubChem CID 77073239) has the molecular formula C12H16F3N3O2 and a molecular weight of 291.27 g/mol. Its IUPAC name is 3-[1,3-dimethyl-5-[methyl(3,3,3-trifluoropropyl)amino]pyrazol-4-yl]prop-2-enoic acid.
| Compound Name | 3-[1,3-dimethyl-5-[methyl(3,3,3-trifluoropropyl)amino]pyrazol-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77073239 |
| Molecular Formula | C12H16F3N3O2 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 3-[1,3-dimethyl-5-[methyl(3,3,3-trifluoropropyl)amino]pyrazol-4-yl]prop-2-enoic acid |
| SMILES | Cc1nn(C)c(N(C)CCC(F)(F)F)c1C=CC(=O)O |
| InChI | InChI=1S/C12H16F3N3O2/c1-8-9(4-5-10(19)20)11(18(3)16-8)17(2)7-6-12(13,14)15/h4-5H,6-7H2,1-3H3,(H,19,20) |
| InChIKey | VMOALOHJPOSSHF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|