C8H17N3O3S — CID 76915793
2-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-hydroxybutanimidamide (PubChem CID 76915793) has the molecular formula C8H17N3O3S and a molecular weight of 235.31 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-hydroxybutanimidamide.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 76915793 |
| Molecular Formula | C8H17N3O3S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-hydroxybutanimidamide |
| SMILES | CCC(C(N)=NO)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C8H17N3O3S/c1-2-7(8(9)10-12)11-3-5-15(13,14)6-4-11/h7,12H,2-6H2,1H3,(H2,9,10) |
| InChIKey | DTAZVRSYAKSSBA-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|