C10H21FN4O — CID 80693908
2-[4-(2-fluoroethyl)piperazin-1-yl]-N'-hydroxybutanimidamide (PubChem CID 80693908) has the molecular formula C10H21FN4O and a molecular weight of 232.30 g/mol. Its IUPAC name is 2-[4-(2-fluoroethyl)piperazin-1-yl]-N'-hydroxybutanimidamide.
| Compound Name | 2-[4-(2-fluoroethyl)piperazin-1-yl]-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 80693908 |
| Molecular Formula | C10H21FN4O |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 2-[4-(2-fluoroethyl)piperazin-1-yl]-N'-hydroxybutanimidamide |
| SMILES | CCC(C(N)=NO)N1CCN(CCF)CC1 |
| InChI | InChI=1S/C10H21FN4O/c1-2-9(10(12)13-16)15-7-5-14(4-3-11)6-8-15/h9,16H,2-8H2,1H3,(H2,12,13) |
| InChIKey | ATFWQZYCOKTDOV-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|