C11H14O2S2 — CID 76918385
3-[5-(propylsulfanylmethyl)thiophen-2-yl]prop-2-enoic acid (PubChem CID 76918385) has the molecular formula C11H14O2S2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 3-[5-(propylsulfanylmethyl)thiophen-2-yl]prop-2-enoic acid.
| Compound Name | 3-[5-(propylsulfanylmethyl)thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76918385 |
| Molecular Formula | C11H14O2S2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 3-[5-(propylsulfanylmethyl)thiophen-2-yl]prop-2-enoic acid |
| SMILES | CCCSCc1ccc(C=CC(=O)O)s1 |
| InChI | InChI=1S/C11H14O2S2/c1-2-7-14-8-10-4-3-9(15-10)5-6-11(12)13/h3-6H,2,7-8H2,1H3,(H,12,13) |
| InChIKey | QBWGTWMWXZLBIU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|