C12H16O2S2 — CID 76918545
3-[5-(butylsulfanylmethyl)thiophen-2-yl]prop-2-enoic acid (PubChem CID 76918545) has the molecular formula C12H16O2S2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 3-[5-(butylsulfanylmethyl)thiophen-2-yl]prop-2-enoic acid.
| Compound Name | 3-[5-(butylsulfanylmethyl)thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76918545 |
| Molecular Formula | C12H16O2S2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 3-[5-(butylsulfanylmethyl)thiophen-2-yl]prop-2-enoic acid |
| SMILES | CCCCSCc1ccc(C=CC(=O)O)s1 |
| InChI | InChI=1S/C12H16O2S2/c1-2-3-8-15-9-11-5-4-10(16-11)6-7-12(13)14/h4-7H,2-3,8-9H2,1H3,(H,13,14) |
| InChIKey | DWUOBXBEXPTBJS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|