C15H27N3O2 — CID 76919438
1-(azocane-1-carbonyl)-N'-hydroxycyclohexane-1-carboximidamide (PubChem CID 76919438) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is 1-(azocane-1-carbonyl)-N'-hydroxycyclohexane-1-carboximidamide.
| Compound Name | 1-(azocane-1-carbonyl)-N'-hydroxycyclohexane-1-carboximidamide |
|---|---|
| PubChem CID | 76919438 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 1-(azocane-1-carbonyl)-N'-hydroxycyclohexane-1-carboximidamide |
| SMILES | NC(=NO)C1(C(=O)N2CCCCCCC2)CCCCC1 |
| InChI | InChI=1S/C15H27N3O2/c16-13(17-20)15(9-5-4-6-10-15)14(19)18-11-7-2-1-3-8-12-18/h20H,1-12H2,(H2,16,17) |
| InChIKey | SDUHHNFNIMSEIF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|