C10H17N3O2 — CID 80591499
N'-hydroxy-1-(pyrrolidine-1-carbonyl)cyclobutane-1-carboximidamide (PubChem CID 80591499) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is N'-hydroxy-1-(pyrrolidine-1-carbonyl)cyclobutane-1-carboximidamide.
| Compound Name | N'-hydroxy-1-(pyrrolidine-1-carbonyl)cyclobutane-1-carboximidamide |
|---|---|
| PubChem CID | 80591499 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | N'-hydroxy-1-(pyrrolidine-1-carbonyl)cyclobutane-1-carboximidamide |
| SMILES | NC(=NO)C1(C(=O)N2CCCC2)CCC1 |
| InChI | InChI=1S/C10H17N3O2/c11-8(12-15)10(4-3-5-10)9(14)13-6-1-2-7-13/h15H,1-7H2,(H2,11,12) |
| InChIKey | LMRGFFZWCGKWMG-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|