C11H21N3O3 — CID 76920747
N-tert-butyl-4-(N'-hydroxycarbamimidoyl)oxane-4-carboxamide (PubChem CID 76920747) has the molecular formula C11H21N3O3 and a molecular weight of 243.31 g/mol. Its IUPAC name is N-tert-butyl-4-(N'-hydroxycarbamimidoyl)oxane-4-carboxamide.
| Compound Name | N-tert-butyl-4-(N'-hydroxycarbamimidoyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 76920747 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | N-tert-butyl-4-(N'-hydroxycarbamimidoyl)oxane-4-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1(C(N)=NO)CCOCC1 |
| InChI | InChI=1S/C11H21N3O3/c1-10(2,3)13-9(15)11(8(12)14-16)4-6-17-7-5-11/h16H,4-7H2,1-3H3,(H2,12,14)(H,13,15) |
| InChIKey | UFSDMDKOLWJBQH-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|