C9H18N4O3 — CID 83023534
4-(dimethylaminocarbamoyl)-N'-hydroxyoxane-4-carboximidamide (PubChem CID 83023534) has the molecular formula C9H18N4O3 and a molecular weight of 230.27 g/mol. Its IUPAC name is 4-(dimethylaminocarbamoyl)-N'-hydroxyoxane-4-carboximidamide.
| Compound Name | 4-(dimethylaminocarbamoyl)-N'-hydroxyoxane-4-carboximidamide |
|---|---|
| PubChem CID | 83023534 |
| Molecular Formula | C9H18N4O3 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 4-(dimethylaminocarbamoyl)-N'-hydroxyoxane-4-carboximidamide |
| SMILES | CN(C)NC(=O)C1(C(N)=NO)CCOCC1 |
| InChI | InChI=1S/C9H18N4O3/c1-13(2)11-8(14)9(7(10)12-15)3-5-16-6-4-9/h15H,3-6H2,1-2H3,(H2,10,12)(H,11,14) |
| InChIKey | GZUWCESFUNYOOM-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|