C9H15N5O2 — CID 76925347
2-(N'-hydroxycarbamimidoyl)-N-(1-methylpyrazol-4-yl)butanamide (PubChem CID 76925347) has the molecular formula C9H15N5O2 and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-(N'-hydroxycarbamimidoyl)-N-(1-methylpyrazol-4-yl)butanamide.
| Compound Name | 2-(N'-hydroxycarbamimidoyl)-N-(1-methylpyrazol-4-yl)butanamide |
|---|---|
| PubChem CID | 76925347 |
| Molecular Formula | C9H15N5O2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2-(N'-hydroxycarbamimidoyl)-N-(1-methylpyrazol-4-yl)butanamide |
| SMILES | CCC(C(=O)Nc1cnn(C)c1)C(N)=NO |
| InChI | InChI=1S/C9H15N5O2/c1-3-7(8(10)13-16)9(15)12-6-4-11-14(2)5-6/h4-5,7,16H,3H2,1-2H3,(H2,10,13)(H,12,15) |
| InChIKey | XCTQADVGJWCICZ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|