C10H17N5O2 — CID 114251780
N-(1-ethylpyrazol-3-yl)-2-[(Z)-N'-hydroxycarbamimidoyl]butanamide (PubChem CID 114251780) has the molecular formula C10H17N5O2 and a molecular weight of 239.28 g/mol. Its IUPAC name is N-(1-ethylpyrazol-3-yl)-2-[(Z)-N'-hydroxycarbamimidoyl]butanamide.
| Compound Name | N-(1-ethylpyrazol-3-yl)-2-[(Z)-N'-hydroxycarbamimidoyl]butanamide |
|---|---|
| PubChem CID | 114251780 |
| Molecular Formula | C10H17N5O2 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | N-(1-ethylpyrazol-3-yl)-2-[(Z)-N'-hydroxycarbamimidoyl]butanamide |
| SMILES | CCC(C(=O)Nc1ccn(CC)n1)/C(N)=N/O |
| InChI | InChI=1S/C10H17N5O2/c1-3-7(9(11)14-17)10(16)12-8-5-6-15(4-2)13-8/h5-7,17H,3-4H2,1-2H3,(H2,11,14)(H,12,13,16) |
| InChIKey | LJCYAHSOOXCNOJ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|