C9H15N3OS — CID 130927400
N-(1-ethylpyrazol-3-yl)-2-sulfanylbutanamide (PubChem CID 130927400) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is N-(1-ethylpyrazol-3-yl)-2-sulfanylbutanamide.
| Compound Name | N-(1-ethylpyrazol-3-yl)-2-sulfanylbutanamide |
|---|---|
| PubChem CID | 130927400 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | N-(1-ethylpyrazol-3-yl)-2-sulfanylbutanamide |
| SMILES | CCC(S)C(=O)Nc1ccn(CC)n1 |
| InChI | InChI=1S/C9H15N3OS/c1-3-7(14)9(13)10-8-5-6-12(4-2)11-8/h5-7,14H,3-4H2,1-2H3,(H,10,11,13) |
| InChIKey | FMLJXCSTHSQWRD-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|