C13H21N3O3 — CID 114250817
2,2-diethyl-4-[(1-ethylpyrazol-3-yl)amino]-4-oxobutanoic acid (PubChem CID 114250817) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 2,2-diethyl-4-[(1-ethylpyrazol-3-yl)amino]-4-oxobutanoic acid.
| Compound Name | 2,2-diethyl-4-[(1-ethylpyrazol-3-yl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 114250817 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 2,2-diethyl-4-[(1-ethylpyrazol-3-yl)amino]-4-oxobutanoic acid |
| SMILES | CCn1ccc(NC(=O)CC(CC)(CC)C(=O)O)n1 |
| InChI | InChI=1S/C13H21N3O3/c1-4-13(5-2,12(18)19)9-11(17)14-10-7-8-16(6-3)15-10/h7-8H,4-6,9H2,1-3H3,(H,18,19)(H,14,15,17) |
| InChIKey | VTQZOXZISXZBFF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |