C11H17N5O4 — CID 76927078
4-(N'-hydroxycarbamimidoyl)-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]oxane-4-carboxamide (PubChem CID 76927078) has the molecular formula C11H17N5O4 and a molecular weight of 283.29 g/mol. Its IUPAC name is 4-(N'-hydroxycarbamimidoyl)-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]oxane-4-carboxamide.
| Compound Name | 4-(N'-hydroxycarbamimidoyl)-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 76927078 |
| Molecular Formula | C11H17N5O4 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 4-(N'-hydroxycarbamimidoyl)-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]oxane-4-carboxamide |
| SMILES | Cc1noc(CNC(=O)C2(C(N)=NO)CCOCC2)n1 |
| InChI | InChI=1S/C11H17N5O4/c1-7-14-8(20-16-7)6-13-10(17)11(9(12)15-18)2-4-19-5-3-11/h18H,2-6H2,1H3,(H2,12,15)(H,13,17) |
| InChIKey | UMZSUCZMKUQKDG-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 135.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|