C13H20N4O3S — CID 76988675
4-(N'-hydroxycarbamimidoyl)-N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]oxane-4-carboxamide (PubChem CID 76988675) has the molecular formula C13H20N4O3S and a molecular weight of 312.40 g/mol. Its IUPAC name is 4-(N'-hydroxycarbamimidoyl)-N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]oxane-4-carboxamide.
| Compound Name | 4-(N'-hydroxycarbamimidoyl)-N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 76988675 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 4-(N'-hydroxycarbamimidoyl)-N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]oxane-4-carboxamide |
| SMILES | Cc1csc(CCNC(=O)C2(C(N)=NO)CCOCC2)n1 |
| InChI | InChI=1S/C13H20N4O3S/c1-9-8-21-10(16-9)2-5-15-12(18)13(11(14)17-19)3-6-20-7-4-13/h8,19H,2-7H2,1H3,(H2,14,17)(H,15,18) |
| InChIKey | AVAGDJCMAZACLX-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|