C12H27N3O2 — CID 76927622
N'-hydroxy-2-[2-(3-methylbutoxy)ethyl-propylamino]ethanimidamide (PubChem CID 76927622) has the molecular formula C12H27N3O2 and a molecular weight of 245.37 g/mol. Its IUPAC name is N'-hydroxy-2-[2-(3-methylbutoxy)ethyl-propylamino]ethanimidamide.
| Compound Name | N'-hydroxy-2-[2-(3-methylbutoxy)ethyl-propylamino]ethanimidamide |
|---|---|
| PubChem CID | 76927622 |
| Molecular Formula | C12H27N3O2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | N'-hydroxy-2-[2-(3-methylbutoxy)ethyl-propylamino]ethanimidamide |
| SMILES | CCCN(CCOCCC(C)C)CC(N)=NO |
| InChI | InChI=1S/C12H27N3O2/c1-4-6-15(10-12(13)14-16)7-9-17-8-5-11(2)3/h11,16H,4-10H2,1-3H3,(H2,13,14) |
| InChIKey | WKRNIBKZVHJYST-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|