About 3-methyl-N-[2-(3-methylbutoxy)ethyl]-N-propylbutan-1-amine;2-methylpentane
3-methyl-N-[2-(3-methylbutoxy)ethyl]-N-propylbutan-1-amine;2-methylpentane (PubChem CID 178112735) has the molecular formula C21H47NO
and a molecular weight of 329.61 g/mol. Its IUPAC name is 3-methyl-N-[2-(3-methylbutoxy)ethyl]-N-propylbutan-1-amine;2-methylpentane.
Molecular Properties
| Compound Name | 3-methyl-N-[2-(3-methylbutoxy)ethyl]-N-propylbutan-1-amine;2-methylpentane |
| PubChem CID | 178112735 |
| Molecular Formula | C21H47NO |
| Molecular Weight | 329.61 g/mol |
| Exact Mass | 329.37 |
| IUPAC Name | 3-methyl-N-[2-(3-methylbutoxy)ethyl]-N-propylbutan-1-amine;2-methylpentane |
| SMILES | CCCC(C)C.CCCN(CCOCCC(C)C)CCC(C)C |
| InChI | InChI=1S/C15H33NO.C6H14/c1-6-9-16(10-7-14(2)3)11-13-17-12-8-15(4)5;1-4-5-6(2)3/h14-15H,6-13H2,1-5H3;6H,4-5H2,1-3H3 |
| InChIKey | BZKKBXQELSPTQU-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.61 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-N-[2-(3-methylbutoxy)ethyl]-N-propylbutan-1-amine;2-methylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-[2-(3-methylbutoxy)ethyl]-N-propylbutan-1-amine;2-methylpentane?
The IUPAC name of 3-methyl-N-[2-(3-methylbutoxy)ethyl]-N-propylbutan-1-amine;2-methylpentane (CID 178112735) is 3-methyl-N-[2-(3-methylbutoxy)ethyl]-N-propylbutan-1-amine;2-methylpentane.
What is the SMILES notation for 3-methyl-N-[2-(3-methylbutoxy)ethyl]-N-propylbutan-1-amine;2-methylpentane?
The canonical SMILES for 3-methyl-N-[2-(3-methylbutoxy)ethyl]-N-propylbutan-1-amine;2-methylpentane is CCCC(C)C.CCCN(CCOCCC(C)C)CCC(C)C.
What is the InChIKey of 3-methyl-N-[2-(3-methylbutoxy)ethyl]-N-propylbutan-1-amine;2-methylpentane?
The InChIKey is BZKKBXQELSPTQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33NO.C6H14/c1-6-9-16(10-7-14(2)3)11-13-17-12-8-15(4)5;1-4-5-6(2)3/h14-15H,6-13H2,1-5H3;6H,4-5H2,1-3H3.
What are the key properties of 3-methyl-N-[2-(3-methylbutoxy)ethyl]-N-propylbutan-1-amine;2-methylpentane?
3-methyl-N-[2-(3-methylbutoxy)ethyl]-N-propylbutan-1-amine;2-methylpentane has a molecular weight of 329.61 g/mol, XLogP of 6.25, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-[2-(3-methylbutoxy)ethyl]-N-propylbutan-1-amine;2-methylpentane is sourced from PubChem (CID 178112735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).