About 3-[4-(2,5-dimethylmorpholin-4-yl)-3-methylphenyl]prop-2-enoic acid
3-[4-(2,5-dimethylmorpholin-4-yl)-3-methylphenyl]prop-2-enoic acid (PubChem CID 76936160) has the molecular formula C16H21NO3
and a molecular weight of 275.35 g/mol. Its IUPAC name is 3-[4-(2,5-dimethylmorpholin-4-yl)-3-methylphenyl]prop-2-enoic acid.
Molecular Properties
| Compound Name | 3-[4-(2,5-dimethylmorpholin-4-yl)-3-methylphenyl]prop-2-enoic acid |
| PubChem CID | 76936160 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 3-[4-(2,5-dimethylmorpholin-4-yl)-3-methylphenyl]prop-2-enoic acid |
| SMILES | Cc1cc(C=CC(=O)O)ccc1N1CC(C)OCC1C |
| InChI | InChI=1S/C16H21NO3/c1-11-8-14(5-7-16(18)19)4-6-15(11)17-9-13(3)20-10-12(17)2/h4-8,12-13H,9-10H2,1-3H3,(H,18,19) |
| InChIKey | LOKFAULCAWBJDH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(2,5-dimethylmorpholin-4-yl)-3-methylphenyl]prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(2,5-dimethylmorpholin-4-yl)-3-methylphenyl]prop-2-enoic acid?
The IUPAC name of 3-[4-(2,5-dimethylmorpholin-4-yl)-3-methylphenyl]prop-2-enoic acid (CID 76936160) is 3-[4-(2,5-dimethylmorpholin-4-yl)-3-methylphenyl]prop-2-enoic acid.
What is the SMILES notation for 3-[4-(2,5-dimethylmorpholin-4-yl)-3-methylphenyl]prop-2-enoic acid?
The canonical SMILES for 3-[4-(2,5-dimethylmorpholin-4-yl)-3-methylphenyl]prop-2-enoic acid is Cc1cc(C=CC(=O)O)ccc1N1CC(C)OCC1C.
What is the InChIKey of 3-[4-(2,5-dimethylmorpholin-4-yl)-3-methylphenyl]prop-2-enoic acid?
The InChIKey is LOKFAULCAWBJDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO3/c1-11-8-14(5-7-16(18)19)4-6-15(11)17-9-13(3)20-10-12(17)2/h4-8,12-13H,9-10H2,1-3H3,(H,18,19).
What are the key properties of 3-[4-(2,5-dimethylmorpholin-4-yl)-3-methylphenyl]prop-2-enoic acid?
3-[4-(2,5-dimethylmorpholin-4-yl)-3-methylphenyl]prop-2-enoic acid has a molecular weight of 275.35 g/mol, XLogP of 2.71, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(2,5-dimethylmorpholin-4-yl)-3-methylphenyl]prop-2-enoic acid is sourced from PubChem (CID 76936160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).