C9H17N5O — CID 76936309
2-[(1-ethylpyrazol-4-yl)methyl-methylamino]-N'-hydroxyethanimidamide (PubChem CID 76936309) has the molecular formula C9H17N5O and a molecular weight of 211.27 g/mol. Its IUPAC name is 2-[(1-ethylpyrazol-4-yl)methyl-methylamino]-N'-hydroxyethanimidamide.
| Compound Name | 2-[(1-ethylpyrazol-4-yl)methyl-methylamino]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 76936309 |
| Molecular Formula | C9H17N5O |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 2-[(1-ethylpyrazol-4-yl)methyl-methylamino]-N'-hydroxyethanimidamide |
| SMILES | CCn1cc(CN(C)CC(N)=NO)cn1 |
| InChI | InChI=1S/C9H17N5O/c1-3-14-6-8(4-11-14)5-13(2)7-9(10)12-15/h4,6,15H,3,5,7H2,1-2H3,(H2,10,12) |
| InChIKey | SEASOMFJAGOJKA-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|