C14H16N2S — CID 76940192
N-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-phenylprop-2-en-1-amine (PubChem CID 76940192) has the molecular formula C14H16N2S and a molecular weight of 244.36 g/mol. Its IUPAC name is N-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-phenylprop-2-en-1-amine.
| Compound Name | N-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-phenylprop-2-en-1-amine |
|---|---|
| PubChem CID | 76940192 |
| Molecular Formula | C14H16N2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | N-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-phenylprop-2-en-1-amine |
| SMILES | Cc1csc(CNCC=Cc2ccccc2)n1 |
| InChI | InChI=1S/C14H16N2S/c1-12-11-17-14(16-12)10-15-9-5-8-13-6-3-2-4-7-13/h2-8,11,15H,9-10H2,1H3 |
| InChIKey | LKUNXBCPNDVFRX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|