C15H22N2O3 — CID 76944505
2-[(2-amino-3,3-dimethylbutanoyl)amino]-2-phenylpropanoic acid (PubChem CID 76944505) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-[(2-amino-3,3-dimethylbutanoyl)amino]-2-phenylpropanoic acid.
| Compound Name | 2-[(2-amino-3,3-dimethylbutanoyl)amino]-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 76944505 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 2-[(2-amino-3,3-dimethylbutanoyl)amino]-2-phenylpropanoic acid |
| SMILES | CC(NC(=O)C(N)C(C)(C)C)(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C15H22N2O3/c1-14(2,3)11(16)12(18)17-15(4,13(19)20)10-8-6-5-7-9-10/h5-9,11H,16H2,1-4H3,(H,17,18)(H,19,20) |
| InChIKey | MQSMSWOLDLYMAP-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |