C9H9F2N3O2 — CID 76948126
N-(2-amino-2-hydroxyiminoethyl)-2,3-difluorobenzamide (PubChem CID 76948126) has the molecular formula C9H9F2N3O2 and a molecular weight of 229.19 g/mol. Its IUPAC name is N-(2-amino-2-hydroxyiminoethyl)-2,3-difluorobenzamide.
| Compound Name | N-(2-amino-2-hydroxyiminoethyl)-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 76948126 |
| Molecular Formula | C9H9F2N3O2 |
| Molecular Weight | 229.19 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | N-(2-amino-2-hydroxyiminoethyl)-2,3-difluorobenzamide |
| SMILES | NC(CNC(=O)c1cccc(F)c1F)=NO |
| InChI | InChI=1S/C9H9F2N3O2/c10-6-3-1-2-5(8(6)11)9(15)13-4-7(12)14-16/h1-3,16H,4H2,(H2,12,14)(H,13,15) |
| InChIKey | PWSQYUYIYGVSFS-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.19 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|