C14H17ClN4O — CID 76949143
3-(4-chloro-3,5-dimethylpyrazol-1-yl)-N'-hydroxy-3-phenylpropanimidamide (PubChem CID 76949143) has the molecular formula C14H17ClN4O and a molecular weight of 292.77 g/mol. Its IUPAC name is 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-N'-hydroxy-3-phenylpropanimidamide.
| Compound Name | 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-N'-hydroxy-3-phenylpropanimidamide |
|---|---|
| PubChem CID | 76949143 |
| Molecular Formula | C14H17ClN4O |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-N'-hydroxy-3-phenylpropanimidamide |
| SMILES | Cc1nn(C(CC(N)=NO)c2ccccc2)c(C)c1Cl |
| InChI | InChI=1S/C14H17ClN4O/c1-9-14(15)10(2)19(17-9)12(8-13(16)18-20)11-6-4-3-5-7-11/h3-7,12,20H,8H2,1-2H3,(H2,16,18) |
| InChIKey | OBOVHOGNJAJUDL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|