About 3-(ethylsulfonylamino)-N'-hydroxy-2-methylpropanimidamide
3-(ethylsulfonylamino)-N'-hydroxy-2-methylpropanimidamide (PubChem CID 76952623) has the molecular formula C6H15N3O3S
and a molecular weight of 209.27 g/mol. Its IUPAC name is 3-(ethylsulfonylamino)-N'-hydroxy-2-methylpropanimidamide.
Molecular Properties
| Compound Name | 3-(ethylsulfonylamino)-N'-hydroxy-2-methylpropanimidamide |
| PubChem CID | 76952623 |
| Molecular Formula | C6H15N3O3S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 3-(ethylsulfonylamino)-N'-hydroxy-2-methylpropanimidamide |
| SMILES | CCS(=O)(=O)NCC(C)C(N)=NO |
| InChI | InChI=1S/C6H15N3O3S/c1-3-13(11,12)8-4-5(2)6(7)9-10/h5,8,10H,3-4H2,1-2H3,(H2,7,9) |
| InChIKey | YSJOSVGBCZAKPC-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(ethylsulfonylamino)-N'-hydroxy-2-methylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(ethylsulfonylamino)-N'-hydroxy-2-methylpropanimidamide?
The IUPAC name of 3-(ethylsulfonylamino)-N'-hydroxy-2-methylpropanimidamide (CID 76952623) is 3-(ethylsulfonylamino)-N'-hydroxy-2-methylpropanimidamide.
What is the SMILES notation for 3-(ethylsulfonylamino)-N'-hydroxy-2-methylpropanimidamide?
The canonical SMILES for 3-(ethylsulfonylamino)-N'-hydroxy-2-methylpropanimidamide is CCS(=O)(=O)NCC(C)C(N)=NO.
What is the InChIKey of 3-(ethylsulfonylamino)-N'-hydroxy-2-methylpropanimidamide?
The InChIKey is YSJOSVGBCZAKPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N3O3S/c1-3-13(11,12)8-4-5(2)6(7)9-10/h5,8,10H,3-4H2,1-2H3,(H2,7,9).
What are the key properties of 3-(ethylsulfonylamino)-N'-hydroxy-2-methylpropanimidamide?
3-(ethylsulfonylamino)-N'-hydroxy-2-methylpropanimidamide has a molecular weight of 209.27 g/mol, XLogP of -0.69, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethylsulfonylamino)-N'-hydroxy-2-methylpropanimidamide is sourced from PubChem (CID 76952623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).