C22H27NO5 — CID 7695424
[(2S)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 2-(1-adamantyl)acetate (PubChem CID 7695424) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is [(2S)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 2-(1-adamantyl)acetate.
| Compound Name | [(2S)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 2-(1-adamantyl)acetate |
|---|---|
| PubChem CID | 7695424 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | [(2S)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 2-(1-adamantyl)acetate |
| SMILES | C[C@H](OC(=O)CC12CC3CC(CC(C3)C1)C2)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H27NO5/c1-13(21(25)23-17-2-3-18-19(7-17)27-12-26-18)28-20(24)11-22-8-14-4-15(9-22)6-16(5-14)10-22/h2-3,7,13-16H,4-6,8-12H2,1H3,(H,23,25)/t13-,14?,15?,16?,22?/m0/s1 |
| InChIKey | QRIYPUAMBZQQAL-QRYOHXEKSA-N |
| XLogP | 3.89 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |