C11H14N2O2 — CID 76955615
2-(phenoxymethyl)-1,3-diazinan-4-one (PubChem CID 76955615) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 2-(phenoxymethyl)-1,3-diazinan-4-one.
| Compound Name | 2-(phenoxymethyl)-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 76955615 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2-(phenoxymethyl)-1,3-diazinan-4-one |
| SMILES | O=C1CCNC(COc2ccccc2)N1 |
| InChI | InChI=1S/C11H14N2O2/c14-11-6-7-12-10(13-11)8-15-9-4-2-1-3-5-9/h1-5,10,12H,6-8H2,(H,13,14) |
| InChIKey | AKTWATGYTMUUEQ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |