C21H18N2O3 — CID 57177449
2-[(3-phenoxyphenoxy)methyl]-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 57177449) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is 2-[(3-phenoxyphenoxy)methyl]-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | 2-[(3-phenoxyphenoxy)methyl]-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 57177449 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 2-[(3-phenoxyphenoxy)methyl]-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | O=C1NC(COc2cccc(Oc3ccccc3)c2)Nc2ccccc21 |
| InChI | InChI=1S/C21H18N2O3/c24-21-18-11-4-5-12-19(18)22-20(23-21)14-25-16-9-6-10-17(13-16)26-15-7-2-1-3-8-15/h1-13,20,22H,14H2,(H,23,24) |
| InChIKey | ZCKYARNHNKINOK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |