C16H17N3O3 — CID 944189
(2S)-3-amino-2-[(3-methoxyphenoxy)methyl]-1,2-dihydroquinazolin-4-one (PubChem CID 944189) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is (2S)-3-amino-2-[(3-methoxyphenoxy)methyl]-1,2-dihydroquinazolin-4-one.
| Compound Name | (2S)-3-amino-2-[(3-methoxyphenoxy)methyl]-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 944189 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (2S)-3-amino-2-[(3-methoxyphenoxy)methyl]-1,2-dihydroquinazolin-4-one |
| SMILES | COc1cccc(OC[C@H]2Nc3ccccc3C(=O)N2N)c1 |
| InChI | InChI=1S/C16H17N3O3/c1-21-11-5-4-6-12(9-11)22-10-15-18-14-8-3-2-7-13(14)16(20)19(15)17/h2-9,15,18H,10,17H2,1H3/t15-/m0/s1 |
| InChIKey | VZDVTSGJNBPDKR-HNNXBMFYSA-N |
| XLogP | 1.84 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|