About 3-amino-2-methyl-1,2-dihydroquinazolin-4-one
3-amino-2-methyl-1,2-dihydroquinazolin-4-one (PubChem CID 126639334) has the molecular formula C9H11N3O
and a molecular weight of 177.21 g/mol. Its IUPAC name is 3-amino-2-methyl-1,2-dihydroquinazolin-4-one.
Molecular Properties
| Compound Name | 3-amino-2-methyl-1,2-dihydroquinazolin-4-one |
| PubChem CID | 126639334 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 3-amino-2-methyl-1,2-dihydroquinazolin-4-one |
| SMILES | CC1Nc2ccccc2C(=O)N1N |
| InChI | InChI=1S/C9H11N3O/c1-6-11-8-5-3-2-4-7(8)9(13)12(6)10/h2-6,11H,10H2,1H3 |
| InChIKey | CIWQDFIRBCPTSL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-methyl-1,2-dihydroquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-methyl-1,2-dihydroquinazolin-4-one?
The IUPAC name of 3-amino-2-methyl-1,2-dihydroquinazolin-4-one (CID 126639334) is 3-amino-2-methyl-1,2-dihydroquinazolin-4-one.
What is the SMILES notation for 3-amino-2-methyl-1,2-dihydroquinazolin-4-one?
The canonical SMILES for 3-amino-2-methyl-1,2-dihydroquinazolin-4-one is CC1Nc2ccccc2C(=O)N1N.
What is the InChIKey of 3-amino-2-methyl-1,2-dihydroquinazolin-4-one?
The InChIKey is CIWQDFIRBCPTSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O/c1-6-11-8-5-3-2-4-7(8)9(13)12(6)10/h2-6,11H,10H2,1H3.
What are the key properties of 3-amino-2-methyl-1,2-dihydroquinazolin-4-one?
3-amino-2-methyl-1,2-dihydroquinazolin-4-one has a molecular weight of 177.21 g/mol, XLogP of 0.77, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-methyl-1,2-dihydroquinazolin-4-one is sourced from PubChem (CID 126639334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).