C11H11N3O — CID 121224563
3-(4-oxo-2,3-dihydro-1H-quinazolin-2-yl)propanenitrile (PubChem CID 121224563) has the molecular formula C11H11N3O and a molecular weight of 201.23 g/mol. Its IUPAC name is 3-(4-oxo-2,3-dihydro-1H-quinazolin-2-yl)propanenitrile.
| Compound Name | 3-(4-oxo-2,3-dihydro-1H-quinazolin-2-yl)propanenitrile |
|---|---|
| PubChem CID | 121224563 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 3-(4-oxo-2,3-dihydro-1H-quinazolin-2-yl)propanenitrile |
| SMILES | N#CCCC1NC(=O)c2ccccc2N1 |
| InChI | InChI=1S/C11H11N3O/c12-7-3-6-10-13-9-5-2-1-4-8(9)11(15)14-10/h1-2,4-5,10,13H,3,6H2,(H,14,15) |
| InChIKey | PMQPDTDYYYVIQD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |