C14H13N5O — CID 135747128
3-[2-cyanoethyl-[(Z)-(2-oxo-1H-indol-3-ylidene)amino]amino]propanenitrile (PubChem CID 135747128) has the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. Its IUPAC name is 3-[2-cyanoethyl-[(Z)-(2-oxo-1H-indol-3-ylidene)amino]amino]propanenitrile.
| Compound Name | 3-[2-cyanoethyl-[(Z)-(2-oxo-1H-indol-3-ylidene)amino]amino]propanenitrile |
|---|---|
| PubChem CID | 135747128 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 3-[2-cyanoethyl-[(Z)-(2-oxo-1H-indol-3-ylidene)amino]amino]propanenitrile |
| SMILES | N#CCCN(CCC#N)/N=C1\C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C14H13N5O/c15-7-3-9-19(10-4-8-16)18-13-11-5-1-2-6-12(11)17-14(13)20/h1-2,5-6H,3-4,9-10H2,(H,17,18,20) |
| InChIKey | PCYZMNHRXRVDSW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|