C11H12N4OS — CID 136665063
1,3-dimethyl-1-[(E)-(2-oxo-1H-indol-3-ylidene)amino]thiourea (PubChem CID 136665063) has the molecular formula C11H12N4OS and a molecular weight of 248.31 g/mol. Its IUPAC name is 1,3-dimethyl-1-[(E)-(2-oxo-1H-indol-3-ylidene)amino]thiourea.
| Compound Name | 1,3-dimethyl-1-[(E)-(2-oxo-1H-indol-3-ylidene)amino]thiourea |
|---|---|
| PubChem CID | 136665063 |
| Molecular Formula | C11H12N4OS |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 1,3-dimethyl-1-[(E)-(2-oxo-1H-indol-3-ylidene)amino]thiourea |
| SMILES | CNC(=S)N(C)/N=C1/C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C11H12N4OS/c1-12-11(17)15(2)14-9-7-5-3-4-6-8(7)13-10(9)16/h3-6H,1-2H3,(H,12,17)(H,13,14,16) |
| InChIKey | YSCCAZDDMSRMNH-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|