About 4-oxo-2,3-dihydro-1H-quinazoline-2-sulfonamide
4-oxo-2,3-dihydro-1H-quinazoline-2-sulfonamide (PubChem CID 67605247) has the molecular formula C8H9N3O3S
and a molecular weight of 227.25 g/mol. Its IUPAC name is 4-oxo-2,3-dihydro-1H-quinazoline-2-sulfonamide.
Molecular Properties
| Compound Name | 4-oxo-2,3-dihydro-1H-quinazoline-2-sulfonamide |
| PubChem CID | 67605247 |
| Molecular Formula | C8H9N3O3S |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 4-oxo-2,3-dihydro-1H-quinazoline-2-sulfonamide |
| SMILES | NS(=O)(=O)C1NC(=O)c2ccccc2N1 |
| InChI | InChI=1S/C8H9N3O3S/c9-15(13,14)8-10-6-4-2-1-3-5(6)7(12)11-8/h1-4,8,10H,(H,11,12)(H2,9,13,14) |
| InChIKey | RVIIKGGRRCEEOP-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-oxo-2,3-dihydro-1H-quinazoline-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-2,3-dihydro-1H-quinazoline-2-sulfonamide?
The IUPAC name of 4-oxo-2,3-dihydro-1H-quinazoline-2-sulfonamide (CID 67605247) is 4-oxo-2,3-dihydro-1H-quinazoline-2-sulfonamide.
What is the SMILES notation for 4-oxo-2,3-dihydro-1H-quinazoline-2-sulfonamide?
The canonical SMILES for 4-oxo-2,3-dihydro-1H-quinazoline-2-sulfonamide is NS(=O)(=O)C1NC(=O)c2ccccc2N1.
What is the InChIKey of 4-oxo-2,3-dihydro-1H-quinazoline-2-sulfonamide?
The InChIKey is RVIIKGGRRCEEOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O3S/c9-15(13,14)8-10-6-4-2-1-3-5(6)7(12)11-8/h1-4,8,10H,(H,11,12)(H2,9,13,14).
What are the key properties of 4-oxo-2,3-dihydro-1H-quinazoline-2-sulfonamide?
4-oxo-2,3-dihydro-1H-quinazoline-2-sulfonamide has a molecular weight of 227.25 g/mol, XLogP of -0.59, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-2,3-dihydro-1H-quinazoline-2-sulfonamide is sourced from PubChem (CID 67605247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).