C8H9N3O3S — CID 67605247
4-oxo-2,3-dihydro-1H-quinazoline-2-sulfonamide (PubChem CID 67605247) has the molecular formula C8H9N3O3S and a molecular weight of 227.25 g/mol. Its IUPAC name is 4-oxo-2,3-dihydro-1H-quinazoline-2-sulfonamide.
| Compound Name | 4-oxo-2,3-dihydro-1H-quinazoline-2-sulfonamide |
|---|---|
| PubChem CID | 67605247 |
| Molecular Formula | C8H9N3O3S |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 4-oxo-2,3-dihydro-1H-quinazoline-2-sulfonamide |
| SMILES | NS(=O)(=O)C1NC(=O)c2ccccc2N1 |
| InChI | InChI=1S/C8H9N3O3S/c9-15(13,14)8-10-6-4-2-1-3-5(6)7(12)11-8/h1-4,8,10H,(H,11,12)(H2,9,13,14) |
| InChIKey | RVIIKGGRRCEEOP-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |