C14H12N2O3 — CID 155486790
2-(2,3-dihydroxyphenyl)-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 155486790) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is 2-(2,3-dihydroxyphenyl)-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | 2-(2,3-dihydroxyphenyl)-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 155486790 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2-(2,3-dihydroxyphenyl)-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | O=C1NC(c2cccc(O)c2O)Nc2ccccc21 |
| InChI | InChI=1S/C14H12N2O3/c17-11-7-3-5-9(12(11)18)13-15-10-6-2-1-4-8(10)14(19)16-13/h1-7,13,15,17-18H,(H,16,19) |
| InChIKey | BKGANBFHAXHZCS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|