C14H13N2O2P — CID 70948912
2-(2-phosphanyloxyphenyl)-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 70948912) has the molecular formula C14H13N2O2P and a molecular weight of 272.24 g/mol. Its IUPAC name is 2-(2-phosphanyloxyphenyl)-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | 2-(2-phosphanyloxyphenyl)-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 70948912 |
| Molecular Formula | C14H13N2O2P |
| Molecular Weight | 272.24 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2-(2-phosphanyloxyphenyl)-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | O=C1NC(c2ccccc2OP)Nc2ccccc21 |
| InChI | InChI=1S/C14H13N2O2P/c17-14-9-5-1-3-7-11(9)15-13(16-14)10-6-2-4-8-12(10)18-19/h1-8,13,15H,19H2,(H,16,17) |
| InChIKey | UJGSQJQOMKSLNM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|