C15H14N2O2 — CID 790493
(2S)-2-(2-hydroxy-5-methylphenyl)-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 790493) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is (2S)-2-(2-hydroxy-5-methylphenyl)-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | (2S)-2-(2-hydroxy-5-methylphenyl)-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 790493 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | (2S)-2-(2-hydroxy-5-methylphenyl)-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | Cc1ccc(O)c([C@@H]2NC(=O)c3ccccc3N2)c1 |
| InChI | InChI=1S/C15H14N2O2/c1-9-6-7-13(18)11(8-9)14-16-12-5-3-2-4-10(12)15(19)17-14/h2-8,14,16,18H,1H3,(H,17,19)/t14-/m0/s1 |
| InChIKey | UTFRIBOOAYXWMS-AWEZNQCLSA-N |
| XLogP | 2.55 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|