C19H16ClN3O — CID 865092
(2S)-2-(2-chloro-6,8-dimethylquinolin-3-yl)-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 865092) has the molecular formula C19H16ClN3O and a molecular weight of 337.81 g/mol. Its IUPAC name is (2S)-2-(2-chloro-6,8-dimethylquinolin-3-yl)-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | (2S)-2-(2-chloro-6,8-dimethylquinolin-3-yl)-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 865092 |
| Molecular Formula | C19H16ClN3O |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | (2S)-2-(2-chloro-6,8-dimethylquinolin-3-yl)-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | Cc1cc(C)c2nc(Cl)c([C@@H]3NC(=O)c4ccccc4N3)cc2c1 |
| InChI | InChI=1S/C19H16ClN3O/c1-10-7-11(2)16-12(8-10)9-14(17(20)22-16)18-21-15-6-4-3-5-13(15)19(24)23-18/h3-9,18,21H,1-2H3,(H,23,24)/t18-/m0/s1 |
| InChIKey | VWTJRPLEQWARJI-SFHVURJKSA-N |
| XLogP | 4.36 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|