C14H10Cl2N2O2 — CID 41143825
(2R)-2-(3,5-dichloro-2-hydroxyphenyl)-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 41143825) has the molecular formula C14H10Cl2N2O2 and a molecular weight of 309.15 g/mol. Its IUPAC name is (2R)-2-(3,5-dichloro-2-hydroxyphenyl)-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | (2R)-2-(3,5-dichloro-2-hydroxyphenyl)-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 41143825 |
| Molecular Formula | C14H10Cl2N2O2 |
| Molecular Weight | 309.15 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | (2R)-2-(3,5-dichloro-2-hydroxyphenyl)-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | O=C1N[C@H](c2cc(Cl)cc(Cl)c2O)Nc2ccccc21 |
| InChI | InChI=1S/C14H10Cl2N2O2/c15-7-5-9(12(19)10(16)6-7)13-17-11-4-2-1-3-8(11)14(20)18-13/h1-6,13,17,19H,(H,18,20)/t13-/m1/s1 |
| InChIKey | XBLHKQFYLHBIAP-CYBMUJFWSA-N |
| XLogP | 3.55 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.15 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|