About biphenylene;sulfamide
biphenylene;sulfamide (PubChem CID 67882419) has the molecular formula C12H12N2O2S
and a molecular weight of 248.31 g/mol. Its IUPAC name is biphenylene;sulfamide.
Molecular Properties
| Compound Name | biphenylene;sulfamide |
| PubChem CID | 67882419 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | biphenylene;sulfamide |
| SMILES | NS(N)(=O)=O.c1ccc2c(c1)-c1ccccc1-2 |
| InChI | InChI=1S/C12H8.H4N2O2S/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11;1-5(2,3)4/h1-8H;(H4,1,2,3,4) |
| InChIKey | SKCVVGOHOKFPFS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze biphenylene;sulfamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of biphenylene;sulfamide?
The IUPAC name of biphenylene;sulfamide (CID 67882419) is biphenylene;sulfamide.
What is the SMILES notation for biphenylene;sulfamide?
The canonical SMILES for biphenylene;sulfamide is NS(N)(=O)=O.c1ccc2c(c1)-c1ccccc1-2.
What is the InChIKey of biphenylene;sulfamide?
The InChIKey is SKCVVGOHOKFPFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8.H4N2O2S/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11;1-5(2,3)4/h1-8H;(H4,1,2,3,4).
What are the key properties of biphenylene;sulfamide?
biphenylene;sulfamide has a molecular weight of 248.31 g/mol, XLogP of 1.48, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for biphenylene;sulfamide is sourced from PubChem (CID 67882419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).