About azane;biphenylene
azane;biphenylene (PubChem CID 21257460) has the molecular formula C12H11N
and a molecular weight of 169.23 g/mol. Its IUPAC name is azane;biphenylene.
Molecular Properties
| Compound Name | azane;biphenylene |
| PubChem CID | 21257460 |
| Molecular Formula | C12H11N |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | azane;biphenylene |
| SMILES | N.c1ccc2c(c1)-c1ccccc1-2 |
| InChI | InChI=1S/C12H8.H3N/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11;/h1-8H;1H3 |
| InChIKey | PUVYYHLAJRLDBH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze azane;biphenylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;biphenylene?
The IUPAC name of azane;biphenylene (CID 21257460) is azane;biphenylene.
What is the SMILES notation for azane;biphenylene?
The canonical SMILES for azane;biphenylene is N.c1ccc2c(c1)-c1ccccc1-2.
What is the InChIKey of azane;biphenylene?
The InChIKey is PUVYYHLAJRLDBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8.H3N/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11;/h1-8H;1H3.
What are the key properties of azane;biphenylene?
azane;biphenylene has a molecular weight of 169.23 g/mol, XLogP of 3.50, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;biphenylene is sourced from PubChem (CID 21257460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).