About biphenylene
biphenylene (PubChem CID 9214) has the molecular formula C12H8
and a molecular weight of 152.20 g/mol. Its IUPAC name is biphenylene.
Molecular Properties
| Compound Name | biphenylene |
| PubChem CID | 9214 |
| Molecular Formula | C12H8 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | biphenylene |
| SMILES | c1ccc2c(c1)-c1ccccc1-2 |
| InChI | InChI=1S/C12H8/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11/h1-8H |
| InChIKey | IFVTZJHWGZSXFD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze biphenylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of biphenylene?
The IUPAC name of biphenylene (CID 9214) is biphenylene.
What is the SMILES notation for biphenylene?
The canonical SMILES for biphenylene is c1ccc2c(c1)-c1ccccc1-2.
What is the InChIKey of biphenylene?
The InChIKey is IFVTZJHWGZSXFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11/h1-8H.
What are the key properties of biphenylene?
biphenylene has a molecular weight of 152.20 g/mol, XLogP of 3.33, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for biphenylene is sourced from PubChem (CID 9214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).