About acetylene;biphenylene
acetylene;biphenylene (PubChem CID 18175768) has the molecular formula C14H10
and a molecular weight of 178.23 g/mol. Its IUPAC name is acetylene;biphenylene.
Molecular Properties
| Compound Name | acetylene;biphenylene |
| PubChem CID | 18175768 |
| Molecular Formula | C14H10 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | acetylene;biphenylene |
| SMILES | C#C.c1ccc2c(c1)-c1ccccc1-2 |
| InChI | InChI=1S/C12H8.C2H2/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11;1-2/h1-8H;1-2H |
| InChIKey | GJCJDYWZXVPHDP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;biphenylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;biphenylene?
The IUPAC name of acetylene;biphenylene (CID 18175768) is acetylene;biphenylene.
What is the SMILES notation for acetylene;biphenylene?
The canonical SMILES for acetylene;biphenylene is C#C.c1ccc2c(c1)-c1ccccc1-2.
What is the InChIKey of acetylene;biphenylene?
The InChIKey is GJCJDYWZXVPHDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8.C2H2/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11;1-2/h1-8H;1-2H.
What are the key properties of acetylene;biphenylene?
acetylene;biphenylene has a molecular weight of 178.23 g/mol, XLogP of 3.58, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;biphenylene is sourced from PubChem (CID 18175768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).