C11H11NO2 — CID 134960358
2-prop-2-enoxy-1,2-dihydroindol-3-one (PubChem CID 134960358) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 2-prop-2-enoxy-1,2-dihydroindol-3-one.
| Compound Name | 2-prop-2-enoxy-1,2-dihydroindol-3-one |
|---|---|
| PubChem CID | 134960358 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 2-prop-2-enoxy-1,2-dihydroindol-3-one |
| SMILES | C=CCOC1Nc2ccccc2C1=O |
| InChI | InChI=1S/C11H11NO2/c1-2-7-14-11-10(13)8-5-3-4-6-9(8)12-11/h2-6,11-12H,1,7H2 |
| InChIKey | IXHWFMFLCUTYOD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|