C18H14N4O — CID 94548593
(2S)-2-(2-phenylpyrimidin-5-yl)-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 94548593) has the molecular formula C18H14N4O and a molecular weight of 302.34 g/mol. Its IUPAC name is (2S)-2-(2-phenylpyrimidin-5-yl)-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | (2S)-2-(2-phenylpyrimidin-5-yl)-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 94548593 |
| Molecular Formula | C18H14N4O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | (2S)-2-(2-phenylpyrimidin-5-yl)-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | O=C1N[C@@H](c2cnc(-c3ccccc3)nc2)Nc2ccccc21 |
| InChI | InChI=1S/C18H14N4O/c23-18-14-8-4-5-9-15(14)21-17(22-18)13-10-19-16(20-11-13)12-6-2-1-3-7-12/h1-11,17,21H,(H,22,23)/t17-/m0/s1 |
| InChIKey | UVALBMZEVQVIEX-KRWDZBQOSA-N |
| XLogP | 3.00 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |