About [2-oxo-2-[(3S)-3-phenyl-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl] 4-hydroxybenzoate
[2-oxo-2-[(3S)-3-phenyl-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl] 4-hydroxybenzoate (PubChem CID 7696027) has the molecular formula C23H19NO4S
and a molecular weight of 405.48 g/mol. Its IUPAC name is [2-oxo-2-[(3S)-3-phenyl-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl] 4-hydroxybenzoate.
Molecular Properties
| Compound Name | [2-oxo-2-[(3S)-3-phenyl-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl] 4-hydroxybenzoate |
| PubChem CID | 7696027 |
| Molecular Formula | C23H19NO4S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | [2-oxo-2-[(3S)-3-phenyl-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl] 4-hydroxybenzoate |
| SMILES | O=C(OCC(=O)N1c2ccccc2SC[C@@H]1c1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C23H19NO4S/c25-18-12-10-17(11-13-18)23(27)28-14-22(26)24-19-8-4-5-9-21(19)29-15-20(24)16-6-2-1-3-7-16/h1-13,20,25H,14-15H2/t20-/m1/s1 |
| InChIKey | UDZQPYCLJQNXCU-HXUWFJFHSA-N |
| XLogP | 4.43 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-oxo-2-[(3S)-3-phenyl-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl] 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-[(3S)-3-phenyl-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl] 4-hydroxybenzoate?
The IUPAC name of [2-oxo-2-[(3S)-3-phenyl-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl] 4-hydroxybenzoate (CID 7696027) is [2-oxo-2-[(3S)-3-phenyl-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl] 4-hydroxybenzoate.
What is the SMILES notation for [2-oxo-2-[(3S)-3-phenyl-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl] 4-hydroxybenzoate?
The canonical SMILES for [2-oxo-2-[(3S)-3-phenyl-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl] 4-hydroxybenzoate is O=C(OCC(=O)N1c2ccccc2SC[C@@H]1c1ccccc1)c1ccc(O)cc1.
What is the InChIKey of [2-oxo-2-[(3S)-3-phenyl-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl] 4-hydroxybenzoate?
The InChIKey is UDZQPYCLJQNXCU-HXUWFJFHSA-N. The full InChI is InChI=1S/C23H19NO4S/c25-18-12-10-17(11-13-18)23(27)28-14-22(26)24-19-8-4-5-9-21(19)29-15-20(24)16-6-2-1-3-7-16/h1-13,20,25H,14-15H2/t20-/m1/s1.
What are the key properties of [2-oxo-2-[(3S)-3-phenyl-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl] 4-hydroxybenzoate?
[2-oxo-2-[(3S)-3-phenyl-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl] 4-hydroxybenzoate has a molecular weight of 405.48 g/mol, XLogP of 4.43, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-[(3S)-3-phenyl-2,3-dihydro-1,4-benzothiazin-4-yl]ethyl] 4-hydroxybenzoate is sourced from PubChem (CID 7696027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).