C23H29NO3 — CID 7696232
N-[2,6-di(propan-2-yl)phenyl]-2-(4-formyl-2,6-dimethylphenoxy)acetamide (PubChem CID 7696232) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-2-(4-formyl-2,6-dimethylphenoxy)acetamide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-2-(4-formyl-2,6-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 7696232 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-2-(4-formyl-2,6-dimethylphenoxy)acetamide |
| SMILES | Cc1cc(C=O)cc(C)c1OCC(=O)Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C23H29NO3/c1-14(2)19-8-7-9-20(15(3)4)22(19)24-21(26)13-27-23-16(5)10-18(12-25)11-17(23)6/h7-12,14-15H,13H2,1-6H3,(H,24,26) |
| InChIKey | CWLFDOKJLATHTB-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|