C24H23NO3 — CID 7696105
N-benzhydryl-2-(4-formyl-2,6-dimethylphenoxy)acetamide (PubChem CID 7696105) has the molecular formula C24H23NO3 and a molecular weight of 373.45 g/mol. Its IUPAC name is N-benzhydryl-2-(4-formyl-2,6-dimethylphenoxy)acetamide.
| Compound Name | N-benzhydryl-2-(4-formyl-2,6-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 7696105 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | N-benzhydryl-2-(4-formyl-2,6-dimethylphenoxy)acetamide |
| SMILES | Cc1cc(C=O)cc(C)c1OCC(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H23NO3/c1-17-13-19(15-26)14-18(2)24(17)28-16-22(27)25-23(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-15,23H,16H2,1-2H3,(H,25,27) |
| InChIKey | GGDAPJMXHXFKHC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|