C20H32 — CID 76969298
(6S)-3-methylidene-6-propan-2-ylcyclohexene;(6R)-3-methylidene-6-propan-2-ylcyclohexene (PubChem CID 76969298) has the molecular formula C20H32 and a molecular weight of 272.48 g/mol. Its IUPAC name is (6S)-3-methylidene-6-propan-2-ylcyclohexene;(6R)-3-methylidene-6-propan-2-ylcyclohexene.
| Compound Name | (6S)-3-methylidene-6-propan-2-ylcyclohexene;(6R)-3-methylidene-6-propan-2-ylcyclohexene |
|---|---|
| PubChem CID | 76969298 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | (6S)-3-methylidene-6-propan-2-ylcyclohexene;(6R)-3-methylidene-6-propan-2-ylcyclohexene |
| SMILES | C=C1C=C[C@@H](C(C)C)CC1.C=C1C=C[C@H](C(C)C)CC1 |
| InChI | InChI=1S/2C10H16/c2*1-8(2)10-6-4-9(3)5-7-10/h2*4,6,8,10H,3,5,7H2,1-2H3/t2*10-/m10/s1 |
| InChIKey | WLPDOAQJXWUPGO-FTYBWHBYSA-N |
| XLogP | 6.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |